Showing Metabocard for (6R)-L-erythro-5,6,7,8-tetrahydrobiopterin (BASm0003846)
| Common Name | (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin |
|---|---|
| Description | Sapropterin, also known as tetrahydrobiopterin, is converted from 7,8-dihydroneopterin triphosphate by 6-pyruvoyl tetrahydropterin synthase and sepiapterin reductase. It is essential in the formation of neurotransmitters and for nitric oxide synthase (PMID: 16946131 ). Sapropterin is part of the folate biosynthesis pathway. It is a substrate for sepiapterin reductase. |
| Structure | |
| Molecular Formula | C9H15N5O3 |
| Average Mass | 241.24710 |
| Monoisotopic Mass | 241.11749 |
| IUPAC Name | 2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-1,4,5,6,7,8-hexahydropteridin-4-one |
| Traditional Name | 2-amino-6-[(1r,2s)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydro-1h-pteridin-4-one |
| CAS Registry Number | 62989-33-7 |
| SMILES | C[C@H](O)[C@H](O)[C@H]1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI Identifier | InChI=1S/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4+,6-/m0/s1 |
| InChI Key | FNKQXYHWGSIFBK-RPDRRWSUSA-N |
| CHEBI ID | CHEBI:59560 |
| HMDB ID | HMDB0000787 |
| State | Not Available |
| Water Solubility | 2.21e+00 g/l |
| logP | -1.66 |
| logS | -2.04 |
| pKa (Strongest Acidic) | 10.01 |
| pKa (Strongest Basic) | 3.58 |
| Hydrogen Acceptor Count | 8 |
| Hydrogen Donor Count | 6 |
| Polar Surface Area | 132 Ų |
| Rotatable Bond Count | 2 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 68.43 m³·mol⁻¹ |
| Polarizability | 23.69 |