Description | Ubiquinone-8, also known as coenzyme q8 or coq8, is a member of the class of compounds known as ubiquinones. Ubiquinones are coenzyme Q derivatives containing a 5, 6-dimethoxy-3-methyl(1,4-benzoquinone) moiety to which an isoprenyl group is attached at ring position 2(or 6). Thus, ubiquinone-8 is considered to be a quinone lipid molecule. Ubiquinone-8 is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Ubiquinone-8 can be found in a number of food items such as kumquat, celery leaves, hazelnut, and jicama, which makes ubiquinone-8 a potential biomarker for the consumption of these food products. Ubiquinone-8 may be a unique E.coli metabolite. |
---|
InChI Identifier | InChI=1S/C49H74O4/c1-36(2)20-13-21-37(3)22-14-23-38(4)24-15-25-39(5)26-16-27-40(6)28-17-29-41(7)30-18-31-42(8)32-19-33-43(9)34-35-45-44(10)46(50)48(52-11)49(53-12)47(45)51/h20,22,24,26,28,30,32,34H,13-19,21,23,25,27,29,31,33,35H2,1-12H3/b37-22+,38-24+,39-26+,40-28+,41-30+,42-32+,43-34+ |
---|