Showing Metabocard for camelliol C (BASm0004291)
Common Name | Camelliol c |
---|---|
Description | Camelliol C is found in fats and oils. Camelliol C is a constituent of sasanqua oil (Camellia sasanqua). |
Structure | |
Molecular Formula | C30H50O |
Average Mass | 426.71740 |
Monoisotopic Mass | 426.38617 |
IUPAC Name | 4,6,6-trimethyl-5-[(3Z,7E,11Z)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraen-1-yl]cyclohex-3-en-1-ol |
Traditional Name | 4,6,6-trimethyl-5-[(3z,7e,11z)-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraen-1-yl]cyclohex-3-en-1-ol |
CAS Registry Number | 220359-76-2 |
SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC[C@@H]1C(C)=CC[C@H](O)C1(C)C |
InChI Identifier | InChI=1S/C30H50O/c1-23(2)13-11-16-25(4)18-12-17-24(3)14-9-10-15-26(5)19-21-28-27(6)20-22-29(31)30(28,7)8/h13-15,18,20,28-29,31H,9-12,16-17,19,21-22H2,1-8H3/b24-14+,25-18-,26-15- |
InChI Key | CIDHBCQEXDUWEB-IVWMLIKNSA-N |
CHEBI ID | CHEBI:62452 |
HMDB ID | HMDB0033195 |
State | Not Available |
Water Solubility | 7.58e-04 g/l |
logP | 7.99 |
logS | -5.75 |
pKa (Strongest Acidic) | 19.40 |
pKa (Strongest Basic) | -0.87 |
Hydrogen Acceptor Count | 1 |
Hydrogen Donor Count | 1 |
Polar Surface Area | 20.23 Ų |
Rotatable Bond Count | 12 |
Physiological Charge | 0 |
Formal Charge | 0 |
Refractivity | 143.30 m³·mol⁻¹ |
Polarizability | 54.74 |