| Description | (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate belongs to alpha amino acids and derivatives class of compounds. Those are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate is soluble (in water) and a weakly acidic compound (based on its pKa). (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate can be found in a number of food items such as mamey sapote, red bell pepper, burbot, and kelp, which makes (4s)-4-hydroxy-2,3,4,5-tetrahydro-(2s)-dipicolinate a potential biomarker for the consumption of these food products. |
|---|
| InChI Identifier | InChI=1S/C7H9NO5/c9-3-1-4(6(10)11)8-5(2-3)7(12)13/h3-4,9H,1-2H2,(H,10,11)(H,12,13)/p-2/t3-,4-/m0/s1 |
|---|
