Showing Metabocard for 2-hydroxybenzoyl-CoA (BASm0004836)
| Common Name | 2-hydroxybenzoyl-coa |
|---|---|
| Description | Salicyloyl-CoA is the intermediate product in the formation of salicyluric acid from salicylic acid. It has been shown to suppress LPS-induced PGE(2) production which effectively complements the action of salicylic acid -- the major metabolite of aspirin (PMID: 10903918 ). Salicyloyl-CoA is metabolized in the liver by mitochondrial acyl CoA:glycine N-acyl transferase (ACGNAT). This enzyme is important in the detoxification of various endogenous and xenobiotic acyl-CoA's. |
| Structure | |
| Molecular Formula | C28H40N7O18P3S |
| Average Mass | 887.64000 |
| Monoisotopic Mass | 887.13634 |
| IUPAC Name | {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-2-({[hydroxy({[hydroxy(3-hydroxy-2,2-dimethyl-3-{[2-({2-[(2-methylphenyl)carbonylsulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}propoxy)phosphoryl]oxy})phosphoryl]oxy}methyl)oxolan-3-yl]oxy}phosphonic acid |
| Traditional Name | [(2r,3s,4r,5r)-5-(6-aminopurin-9-yl)-4-hydroxy-2-[({hydroxy[hydroxy(3-hydroxy-2,2-dimethyl-3-{[2-({2-[(2-methylphenyl)carbonylsulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}propoxy)phosphoryl]oxyphosphoryl}oxy)methyl]oxolan-3-yl]oxyphosphonic acid |
| CAS Registry Number | 10478-66-7 |
| SMILES | CC(C)(COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)c1ccccc1O |
| InChI Identifier | InChI=1S/C28H40N7O18P3S/c1-28(2,22(39)25(40)31-8-7-18(37)30-9-10-57-27(41)15-5-3-4-6-16(15)36)12-50-56(47,48)53-55(45,46)49-11-17-21(52-54(42,43)44)20(38)26(51-17)35-14-34-19-23(29)32-13-33-24(19)35/h3-6,13-14,17,20-22,26,36,38-39H,7-12H2,1-2H3,(H,30,37)(H,31,40)(H,45,46)(H,47,48)(H2,29,32,33)(H2,42,43,44)/t17-,20-,21-,22+,26-/m1/s1 |
| InChI Key | YTKKDFTVSNSVEE-TYHXJLICSA-N |
| CHEBI ID | CHEBI:67148 |
| HMDB ID | HMDB0011636 |
| State | Solid |
| Water Solubility | 3.33e+00 g/l |
| logP | 0.10 |
| logS | -2.42 |
| pKa (Strongest Acidic) | 0.83 |
| pKa (Strongest Basic) | 4.95 |
| Hydrogen Acceptor Count | 17 |
| Hydrogen Donor Count | 9 |
| Polar Surface Area | 363.63 Ų |
| Rotatable Bond Count | 21 |
| Physiological Charge | -4 |
| Formal Charge | 0 |
| Refractivity | 197.92 m³·mol⁻¹ |
| Polarizability | 79.89 |