Showing Metabocard for dihydrocurcumin (BASm0004860)
| Common Name | Dihydrocurcumin |
|---|---|
| Description | Dihydrocurcumin is found in herbs and spices. Dihydrocurcumin is a constituent of Curcuma longa (turmeric) |
| Structure | |
| Molecular Formula | C21H22O6 |
| Average Mass | 370.39580 |
| Monoisotopic Mass | 370.14164 |
| IUPAC Name | (1E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione |
| Traditional Name | (1e)-1,7-bis(4-hydroxy-3-methoxyphenyl)hept-1-ene-3,5-dione |
| CAS Registry Number | 76474-56-1 |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI Identifier | InChI=1S/C21H22O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3,5-7,9-12,24-25H,4,8,13H2,1-2H3/b7-3+ |
| InChI Key | MUYJSOCNDLUHPJ-XVNBXDOJSA-N |
| CHEBI ID | CHEBI:67262 |
| HMDB ID | HMDB0031552 |
| State | Not Available |
| Water Solubility | 5.28e-03 g/l |
| logP | 3.50 |
| logS | -4.85 |
| pKa (Strongest Acidic) | 9.17 |
| pKa (Strongest Basic) | -4.45 |
| Hydrogen Acceptor Count | 6 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 93.06 Ų |
| Rotatable Bond Count | 9 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 102.72 m³·mol⁻¹ |
| Polarizability | 38.95 |