Showing Metabocard for 2-(9Z-octadecenoyl)-glycerol (BASm0005302)
| Common Name | 2-(9z-octadecenoyl)-glycerol |
|---|---|
| Description | MG(0:0/18:1(9Z)/0:0) is a monoacylglyceride. A monoglyceride, more correctly known as a monoacylglycerol, is a glyceride consisting of one fatty acid chain covalently bonded to a glycerol molecule through an ester linkage. Monoacylglycerol can be broadly divided into two groups; 1-monoacylglycerols (or 3-monoacylglycerols) and 2-monoacylglycerols, depending on the position of the ester bond on the glycerol moiety. Normally the 1-/3-isomers are not distinguished from each other and are termed 'alpha-monoacylglycerols', while the 2-isomers are beta-monoacylglycerols. Monoacylglycerols are formed biochemically via release of a fatty acid from diacylglycerol by diacylglycerol lipase or hormone sensitive lipase. Monoacylglycerols are broken down by monoacylglycerol lipase. They tend to be minor components only of most plant and animal tissues, and indeed would not be expected to accumulate because their strong detergent properties would have a disruptive effect on membranes. 2-Monoacylglycerols are a major end product of the intestinal digestion of dietary fats in animals via the enzyme pancreatic lipase. They are taken up directly by the intestinal cells and converted to triacylglycerols via the monoacylglycerol pathway before being transported in lymph to the liver. Mono- and Diglycerides are commonly added to commercial food products in small quantities. They act as emulsifiers, helping to mix ingredients such as oil and water that would not otherwise blend well. |
| Structure | |
| Molecular Formula | C21H40O4 |
| Average Mass | 356.53990 |
| Monoisotopic Mass | 356.29266 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (9Z)-octadec-9-enoate |
| Traditional Name | 1,3-dihydroxypropan-2-yl (9z)-octadec-9-enoate |
| CAS Registry Number | Not Available |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)CO |
| InChI Identifier | InChI=1S/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-20(18-22)19-23/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9- |
| InChI Key | UPWGQKDVAURUGE-KTKRTIGZSA-N |
| CHEBI ID | CHEBI:73990 |
| HMDB ID | HMDB0011537 |
| State | Solid |
| Water Solubility | 1.66e-03 g/l |
| logP | 6.25 |
| logS | -5.33 |
| pKa (Strongest Acidic) | 14.28 |
| pKa (Strongest Basic) | -2.98 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 66.76 Ų |
| Rotatable Bond Count | 19 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 104.43 m³·mol⁻¹ |
| Polarizability | 44.89 |