Showing Metabocard for D-asparagine (BASm0005428)
| Common Name | D-asparagine |
|---|---|
| Description | D-Asparagine, also known as DSG, belongs to the class of organic compounds known as asparagine and derivatives. D-Asparagome is a non-essential amino acid that is involved in the metabolic control of cell functions in nerve and brain tissue. Asparagine and derivatives are compounds containing asparagine or a derivative thereof resulting from reaction of asparagine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. It is codified by the codons AAU and AAC. It is biosynthesized from Aspartic acid and Ammonia by asparagine synthetase. |
| Structure | |
| Molecular Formula | C4H8N2O3 |
| Average Mass | 132.11790 |
| Monoisotopic Mass | 132.05349 |
| IUPAC Name | (2R)-2-amino-3-carbamoylpropanoic acid |
| Traditional Name | D-asparagine |
| CAS Registry Number | 2058-58-4 |
| SMILES | NC(=O)C[C@@H]([NH3+])C(=O)[O-] |
| InChI Identifier | InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9)/t2-/m1/s1 |
| InChI Key | DCXYFEDJOCDNAF-UWTATZPHSA-N |
| CHEBI ID | CHEBI:74337 |
| HMDB ID | HMDB0033780 |
| State | Solid |
| Water Solubility | 1.68e+02 g/l |
| logP | -3.36 |
| logS | 0.10 |
| pKa (Strongest Acidic) | 2.00 |
| pKa (Strongest Basic) | 8.43 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 106.41 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 28.35 m³·mol⁻¹ |
| Polarizability | 11.77 |