Showing Metabocard for 3-hydroxydodecanoate (BASm0005977)
| Common Name | 3-hydroxydodecanoate |
|---|---|
| Description | 3-Hydroxydodecanoic acid (CAS: 1883-13-2) is a medium-chain fatty acid associated with fatty acid metabolic disorders (PMID: 11948802 ). Deficiency of medium-chain acyl-CoA dehydrogenase is characterized by an intolerance to prolonged fasting, recurrent episodes of hypoglycemic coma with medium-chain dicarboxylic aciduria, impaired ketogenesis, and low plasma and tissue carnitine levels (OMIM: 201450 ). 3-Hydroxydodecanoic acid is also a microbial metabolite found in Acinetobacter, Moraxella, and Pseudomonas (PMID: 21687748 ). 3-Hydroxydodecanoic acid has been identified in the human placenta (PMID: 32033212 ). |
| Structure | |
| Molecular Formula | C12H24O3 |
| Average Mass | 216.32100 |
| Monoisotopic Mass | 216.17254 |
| IUPAC Name | 3-hydroxydodecanoic acid |
| Traditional Name | 3-hydroxylauric acid |
| CAS Registry Number | 45162-48-9 |
| SMILES | CCCCCCCCCC(O)CC(=O)[O-] |
| InChI Identifier | InChI=1S/C12H24O3/c1-2-3-4-5-6-7-8-9-11(13)10-12(14)15/h11,13H,2-10H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChI Key | MUCMKTPAZLSKTL-NSHDSACASA-N |
| CHEBI ID | CHEBI:76616 |
| HMDB ID | HMDB0000387 |
| State | Solid |
| Water Solubility | 3.45e-01 g/l |
| logP | 3.63 |
| logS | -2.80 |
| pKa (Strongest Acidic) | 4.67 |
| pKa (Strongest Basic) | -2.80 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 57.53 Ų |
| Rotatable Bond Count | 10 |
| Physiological Charge | -1 |
| Formal Charge | 0 |
| Refractivity | 60.20 m³·mol⁻¹ |
| Polarizability | 26.59 |