Showing Metabocard for (2S)-2-amino-3-oxobutanoate (BASm0006670)
| Common Name | (2s)-2-amino-3-oxobutanoate | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Description | L-2-Amino-3-oxobutanoic acid or L-2-amino acetic acid is involved in glycine/serine metabolism and is a breakdown product from glycine. It spontaneously decomposes to aminoacetone. Delta-aminolevuliinate synthase is the enzyme that catalyzes the interconversion between glycine and L-2-amino-3-oxobutanoic acid. Glycine C-acetyltransferase is also capable of catalyzing this reaction. | ||||||||||||||||||
| Structure | |||||||||||||||||||
| Molecular Formula | C4H7NO3 | ||||||||||||||||||
| Average Mass | 117.10330 | ||||||||||||||||||
| Monoisotopic Mass | 117.04259 | ||||||||||||||||||
| IUPAC Name | (2S)-2-amino-3-oxobutanoic acid | ||||||||||||||||||
| Traditional Name | (2s)-2-amino-3-oxobutanoic acid | ||||||||||||||||||
| CAS Registry Number | Not Available | ||||||||||||||||||
| SMILES | CC(=O)[C@H]([NH3+])C(=O)[O-] | ||||||||||||||||||
| InChI Identifier | InChI=1S/C4H7NO3/c1-2(6)3(5)4(7)8/h3H,5H2,1H3,(H,7,8)/t3-/m0/s1 | ||||||||||||||||||
| InChI Key | SAUCHDKDCUROAO-VKHMYHEASA-N | ||||||||||||||||||
| CHEBI ID | CHEBI:78948 | ||||||||||||||||||
| HMDB ID | HMDB0006454 | ||||||||||||||||||
| Pathways |
| ||||||||||||||||||
| State | Solid | ||||||||||||||||||
| Water Solubility | 2.06e+02 g/l | ||||||||||||||||||
| logP | -2.63 | ||||||||||||||||||
| logS | 0.25 | ||||||||||||||||||
| pKa (Strongest Acidic) | 1.87 | ||||||||||||||||||
| pKa (Strongest Basic) | 7.25 | ||||||||||||||||||
| Hydrogen Acceptor Count | 4 | ||||||||||||||||||
| Hydrogen Donor Count | 2 | ||||||||||||||||||
| Polar Surface Area | 80.39 Ų | ||||||||||||||||||
| Rotatable Bond Count | 2 | ||||||||||||||||||
| Physiological Charge | 0 | ||||||||||||||||||
| Formal Charge | 0 | ||||||||||||||||||
| Refractivity | 25.53 m³·mol⁻¹ | ||||||||||||||||||
| Polarizability | 10.51 |