Showing Metabocard for pentyl propanoate (BASm0007615)
Common Name | Pentyl propanoate |
---|---|
Description | Pentyl propanoate is a flavouring ingredient Pentyl propanoate is an organic compound which is the ester formed by the condensation of pentanol and propanoic acid. It is also known as apricot essence |
Structure | |
Molecular Formula | C8H16O2 |
Average Mass | 144.21140 |
Monoisotopic Mass | 144.11503 |
IUPAC Name | pentyl propanoate |
Traditional Name | Amyl propionate |
CAS Registry Number | 624-54-4 |
SMILES | CCCCCOC(=O)CC |
InChI Identifier | InChI=1S/C8H16O2/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3 |
InChI Key | TWSRVQVEYJNFKQ-UHFFFAOYSA-N |
CHEBI ID | CHEBI:87373 |
HMDB ID | HMDB0031638 |
State | Liquid |
Water Solubility | 1.00e+00 g/l |
logP | 2.93 |
logS | -2.16 |
pKa (Strongest Acidic) | Not Available |
pKa (Strongest Basic) | -7.03 |
Hydrogen Acceptor Count | 1 |
Hydrogen Donor Count | 0 |
Polar Surface Area | 26.3 Ų |
Rotatable Bond Count | 6 |
Physiological Charge | 0 |
Formal Charge | 0 |
Refractivity | 40.51 m³·mol⁻¹ |
Polarizability | 17.51 |