Showing Metabocard for cis-3-hydroxy-D-proline (BASm0007719)
| Common Name | Cis-3-hydroxy-d-proline |
|---|---|
| Description | Constituent of collagen and the antibiotic Telomycin (Combined Chemical Dictionary). |
| Structure | |
| Molecular Formula | C5H9NO3 |
| Average Mass | 131.12990 |
| Monoisotopic Mass | 131.05824 |
| IUPAC Name | (2R,3S)-3-hydroxypyrrolidine-2-carboxylic acid |
| Traditional Name | (2r,3s)-3-hydroxypyrrolidine-2-carboxylic acid |
| CAS Registry Number | 4298-08-02 |
| SMILES | O=C([O-])[C@@H]1[NH2+]CC[C@@H]1O |
| InChI Identifier | InChI=1S/C5H9NO3/c7-3-1-2-6-4(3)5(8)9/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4+/m0/s1 |
| InChI Key | BJBUEDPLEOHJGE-IUYQGCFVSA-N |
| CHEBI ID | CHEBI:87840 |
| HMDB ID | HMDB0002113 |
| State | Solid |
| Water Solubility | 4.31e+02 g/l |
| logP | -3.18 |
| logS | 0.52 |
| pKa (Strongest Acidic) | 1.61 |
| pKa (Strongest Basic) | 10.62 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 69.56 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 29.38 m³·mol⁻¹ |
| Polarizability | 12.16 |