Showing Metabocard for 10-epi-juneol (BASm0009076)
| Common Name | 10-epi-juneol |
|---|---|
| Description | Junenol is found in alcoholic beverages. Junenol is a constituent of the juniper berry (Juniperus communis) |
| Structure | |
| Molecular Formula | C15H26O |
| Average Mass | 222.36630 |
| Monoisotopic Mass | 222.19837 |
| IUPAC Name | 4a-methyl-8-methylidene-2-(propan-2-yl)-decahydronaphthalen-1-ol |
| Traditional Name | 2-isopropyl-4a-methyl-8-methylidene-octahydronaphthalen-1-ol |
| CAS Registry Number | 62358-38-7 |
| SMILES | C=C1CCC[C@@]2(C)CC[C@@H](C(C)C)[C@H](O)[C@@H]12 |
| InChI Identifier | InChI=1S/C15H26O/c1-10(2)12-7-9-15(4)8-5-6-11(3)13(15)14(12)16/h10,12-14,16H,3,5-9H2,1-2,4H3 |
| InChI Key | MSJJKJCIFIGTJY-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:138037 |
| HMDB ID | HMDB0034982 |
| State | Not Available |
| Water Solubility | 1.34e-02 g/l |
| logP | 3.54 |
| logS | -4.22 |
| pKa (Strongest Acidic) | Not Available |
| pKa (Strongest Basic) | -0.19 |
| Hydrogen Acceptor Count | 1 |
| Hydrogen Donor Count | 1 |
| Polar Surface Area | 20.23 Ų |
| Rotatable Bond Count | 1 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 68.12 m³·mol⁻¹ |
| Polarizability | 27.46 |