Showing Metabocard for L-histidyl-L-leucine (BASm0010866)
| Common Name | L-histidyl-l-leucine |
|---|---|
| Description | Histidylleucine is a dipeptide composed of histidine and leucine. It is an incomplete breakdown product of protein digestion or protein catabolism. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Some dipeptides are known to have physiological or cell-signalling effects although most are simply short-lived intermediates on their way to specific amino acid degradation pathways following further proteolysis. |
| Structure | |
| Molecular Formula | C12H20N4O3 |
| Average Mass | 268.31700 |
| Monoisotopic Mass | 268.15354 |
| IUPAC Name | 2-[2-amino-3-(1H-imidazol-5-yl)propanamido]-4-methylpentanoic acid |
| Traditional Name | 2-[2-amino-3-(3h-imidazol-4-yl)propanamido]-4-methylpentanoic acid |
| CAS Registry Number | 7763-65-7 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]([NH3+])Cc1c[nH]cn1)C(=O)[O-] |
| InChI Identifier | InChI=1S/C12H20N4O3/c1-7(2)3-10(12(18)19)16-11(17)9(13)4-8-5-14-6-15-8/h5-7,9-10H,3-4,13H2,1-2H3,(H,14,15)(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
| InChI Key | MMFKFJORZBJVNF-UWVGGRQHSA-N |
| CHEBI ID | CHEBI:147392 |
| HMDB ID | HMDB0028889 |
| State | Solid |
| Water Solubility | 3.30e+00 g/l |
| logP | -2.00 |
| logS | -1.91 |
| pKa (Strongest Acidic) | 3.61 |
| pKa (Strongest Basic) | 8.02 |
| Hydrogen Acceptor Count | 5 |
| Hydrogen Donor Count | 4 |
| Polar Surface Area | 121.1 Ų |
| Rotatable Bond Count | 7 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 69.03 m³·mol⁻¹ |
| Polarizability | 28.03 |