Showing Metabocard for N-(2-carboxyethyl)putrescine (BASm0011803)
| Common Name | N-(2-carboxyethyl)putrescine |
|---|---|
| Description | Putreanine is a new amino acid isolated from mammalian and bird brain.Its structure represents a condensation of putrescine and b-alanine and is therefore named putreanine.This amino acid can be synthesized by condensation of 4-phthalimino-1-bromobutane and ethyl b-alaninate followed by add hydrolysis.It was only detected in the central nervous system of mammalian and avian organisms. Its concentration was highest in caudal regions of the brain, and the white matter of the cerebral and cerebellar cortices and the spinal cord contained more than grey matter of the corresponding areas. Putreanine appears in the brain of rats 2 weeks after birth and subsequently its concentration increases for several months.The concentration of this amino acid in mammalian brain is roughly 50 mmoles per g, which is comparable to the concentrations of branched amino acids, aromatic amino acids, histidine, and ornithine in the same tissue.[PMID:5350953 ]. |
| Structure | |
| Molecular Formula | C7H17N2O2 |
| Average Mass | 161.22210 |
| Monoisotopic Mass | 161.12900 |
| IUPAC Name | 3-[(4-azaniumylbutyl)amino]propanoic acid |
| Traditional Name | 3-[(4-aminiobutyl)amino]propanoic acid |
| CAS Registry Number | 25887-39-2 |
| SMILES | [NH3+]CCCC[NH2+]CCC(=O)[O-] |
| InChI Identifier | InChI=1S/C7H16N2O2/c8-4-1-2-5-9-6-3-7(10)11/h9H,1-6,8H2,(H,10,11)/p+1 |
| InChI Key | BTSHXVLJDRJCMM-UHFFFAOYSA-O |
| CHEBI ID | CHEBI:180912 |
| HMDB ID | HMDB0006078 |
| State | Solid |
| Water Solubility | 9.23e+00 g/l |
| logP | -2.40 |
| logS | -1.33 |
| pKa (Strongest Acidic) | 4.05 |
| pKa (Strongest Basic) | 10.69 |
| Hydrogen Acceptor Count | 3 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 76.97 Ų |
| Rotatable Bond Count | 7 |
| Physiological Charge | 1 |
| Formal Charge | 1 |
| Refractivity | 54.23 m³·mol⁻¹ |
| Polarizability | 18.47 |