Showing Metabocard for 3-chloro-L-tyrosine (BASm0011969)
| Common Name | 3-chloro-l-tyrosine |
|---|---|
| Description | 3-Chlorotyrosine, a specific marker of myeloperoxidase-catalyzed oxidation, is markedly elevated in low density lipoprotein isolated from human atherosclerotic intima. (PMID 9151778 ). In particular, myeloperoxidase halogenates tyrosine residues in plasma proteins and and generates 3-chlorotyrosine (CY). The detection of free chlorotyrosine in blood or urine arises from the degradation of these chlorinated proteins. CY concentrations may be useful for monitoring the activation of neutrophils in asthmatic patients (PMID 15196282 ). |
| Structure | |
| Molecular Formula | C9H10ClNO3 |
| Average Mass | 215.63400 |
| Monoisotopic Mass | 215.03492 |
| IUPAC Name | 2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| Traditional Name | 2-amino-3-(3-chloro-4-hydroxyphenyl)propanoic acid |
| CAS Registry Number | 7423-93-0 |
| SMILES | [NH3+][C@@H](Cc1ccc(O)c(Cl)c1)C(=O)[O-] |
| InChI Identifier | InChI=1S/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| InChI Key | ACWBBAGYTKWBCD-UHFFFAOYSA-N |
| CHEBI ID | CHEBI:189422 |
| HMDB ID | HMDB0001885 |
| State | Solid |
| Water Solubility | 1.01e+00 g/l |
| logP | -1.65 |
| logS | -2.33 |
| pKa (Strongest Acidic) | 1.56 |
| pKa (Strongest Basic) | 9.47 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 3 |
| Polar Surface Area | 83.55 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 51.90 m³·mol⁻¹ |
| Polarizability | 20.35 |