Showing Metabocard for L-aspartate 4-semialdehyde (BASm0013246)
| Common Name | L-aspartate 4-semialdehyde |
|---|---|
| Description | L-Aspartate-semialdehyde (CAS: 15106-57-7) is involved in both the lysine biosynthesis I and homoserine biosynthesis pathways. In the lysine biosynthesis I pathway, L-aspartate-semialdehyde is produced from a reaction between L-aspartyl-4-phosphate and NADPH, with phosphate and NADP+ as byproducts. The reaction is catalyzed by aspartate-semialdehyde dehydrogenase. L-Aspartate-semialdehyde reacts with pyruvate to produce L-2,3-dihydrodipicolinate and water. Dihydrodipicolinate synthase catalyzes this reaction. In the homoserine biosynthesis pathway, L-aspartate-semialdehyde is produced from a reaction between L-aspartyl-4-phosphate and NADPH, with phosphate and NADP+ as byproducts. The reaction is catalyzed by aspartate-semialdehyde dehydrogenase. L-Aspartate-semialdehyde reacts with NAD(P)H and H+ to form homoserine and NAD(P)+. |
| Structure | |
| Molecular Formula | C4H7NO3 |
| Average Mass | 117.10330 |
| Monoisotopic Mass | 117.04259 |
| IUPAC Name | (2S)-2-amino-4-oxobutanoic acid |
| Traditional Name | L-aspartic 4-semialdehyde |
| CAS Registry Number | 160042 |
| SMILES | [NH3+][C@@H](CC=O)C(=O)[O-] |
| InChI Identifier | InChI=1S/C4H7NO3/c5-3(1-2-6)4(7)8/h2-3H,1,5H2,(H,7,8)/t3-/m0/s1 |
| InChI Key | HOSWPDPVFBCLSY-VKHMYHEASA-N |
| CHEBI ID | CHEBI:537519 |
| HMDB ID | HMDB0012249 |
| State | Solid |
| Water Solubility | 2.25e+02 g/l |
| logP | -2.73 |
| logS | 0.28 |
| pKa (Strongest Acidic) | 1.95 |
| pKa (Strongest Basic) | 8.98 |
| Hydrogen Acceptor Count | 4 |
| Hydrogen Donor Count | 2 |
| Polar Surface Area | 80.39 Ų |
| Rotatable Bond Count | 3 |
| Physiological Charge | 0 |
| Formal Charge | 0 |
| Refractivity | 25.61 m³·mol⁻¹ |
| Polarizability | 10.51 |